Home > Banco de Questões > Química > Hidrocarbonetos >Principais Funções dos Hidrocarbonetos

Principais Funções dos Hidrocarbonetos

Lista de 10 exercícios de Química com gabarito sobre o tema Principais Funções dos Hidrocarbonetos com questões de Vestibulares.


Você pode conferir as videoaulas, conteúdo de teoria, e mais questões sobre o tema Principais Funções dos Hidrocarbonetos.


01. (Unesp) O octano é um dos principais constituintes da gasolina, que é uma mistura de hidrocarbonetos. A fórmula molecular do octano é:

  1. C8H18
  2. C8H16
  3. C8H14
  4. C12H24
  5. C18H38

02. (UFU-MG) A substância de fórmula C8H16 representa um:

  1. alcano de cadeia aberta.
  2. alceno de cadeia aberta.
  3. alcino de cadeia aberta.
  4. composto aromático.
  5. alcino de cadeia fechada.

03. (PUC-PR) Alcinos são hidrocarbonetos:

  1. alifáticos saturados.
  2. alicíclicos saturados.
  3. alifáticos insaturados com dupla ligação.
  4. alicíclicos insaturados com tripla ligação.
  5. alifáticos insaturados com tripla ligação.

04. (Uel) Um dos hidrocarbonetos de fórmula C5H12 pode ter cadeia carbônica:

  1. cíclica saturada.
  2. acíclica heterogênea.
  3. cíclica ramificada.
  4. aberta insaturada.
  5. aberta ramificada.

05. (UFSCar-SP) Considere as afirmações seguintes sobre hidrocarbonetos.

I) Hidrocarbonetos são compostos orgânicos constituídos somente de carbono e hidrogênio.

II) São chamados de alcenos somente os hidrocarbonetos insaturados de cadeia linear.

III) Cicloalcanos são hidrocarbonetos alifáticos saturados de fórmula geral CnH2n.

IV) São hidrocarbonetos aromáticos: bromobenzeno, p-nitrotolueno e naftaleno.

São corretas as afirmações:

  1. I e III, apenas.
  2. I, III e IV, apenas.
  3. II e III, apenas.
  4. III e IV, apenas.
  5. I, II e IV, apenas.

06. (FATEC) O gás liquefeito de petróleo, GLP, é uma mistura de propano, C3H8, e butano, C4H10. Logo, esse gás é uma mistura de hidrocarbonetos da classe dos:

  1. alcanos.
  2. alcenos.
  3. alcinos.
  4. cicloalcanos.
  5. cicloalcenos.

07. (UERJ) Um processo petroquímico gerou a mistura, em partes iguais, dos alcinos com fórmula molecular C6 H10. Por meio de um procedimento de análise, determinou-se que essa mistura continha 24 gramas de moléculas de alcinos que possuem átomo de hidrogênio ligado a átomo de carbono insaturado.

A massa da mistura, em gramas, corresponde a:

  1. 30
  2. 36
  3. 42
  4. 48

08. (UECE) Nos compostos orgânicos, os átomos de carbono se ligam entre si ou com outros átomos e formam as cadeias carbônicas, que podem ser: abertas, fechadas ou mistas; normais ou ramificadas; saturadas ou insaturadas; homogêneas ou heterogêneas. O composto 3,7-dimetil-2,6-octadienal, conhecido como citral, usado na indústria alimentícia e para fortalecer o óleo de limão, possui a seguinte fórmula molecular: C9H15COH. A classificação correta da sua cadeia carbônica é

  1. aberta, insaturada, heterogênea e ramificada.
  2. mista, saturada, heterogênea e normal.
  3. aberta, insaturada, homogênea e ramificada.
  4. aberta, saturada, homogênea e ramificada.

09. (PUC-RJ) Um grupo de compostos, denominado ácidos graxos, constitui a mais importante fonte de energia na dieta do Homem. Um exemplo destes é o ácido linoleico, presente no leite humano. A sua fórmula estrutural simplificada é:

CH3(CH2)4(CH)2CH2(CH)2(CH2)7COOH

Sua cadeia carbônica é classificada como:

  1. Aberta, normal, saturada e homogênea.
  2. Aberta, normal, insaturada e heterogênea.
  3. Aberta, ramificada, insaturada e heterogênea.
  4. Aberta, ramificada, saturada e homogênea.
  5. Aberta, normal, insaturada e homogênea.

10. (UERJ) “O Ministério da Saúde adverte: fumar pode causar câncer de pulmão.” Um dos responsáveis por esse mal causado pelo cigarro é o alcatrão, que corresponde a uma mistura de substâncias aromáticas, entre elas benzeno, naftaleno e antraceno.

As fórmulas moleculares dos três hidrocarbonetos citados são respectivamente:

  1. C6H12, C12H12, C18H20
  2. C6H12, C12H10, C18H18
  3. C6H6, C10H10, C14H14
  4. C6H6, C10H8, C14H

Você acredita que o gabarito esteja incorreto? Avisa aí 😰| Email ou WhatsApp



Você acredita que o gabarito esteja incorreto? Avisa aí 😰| Email ou WhatsApp